C18H15FN2OS — CID 82152301
5-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2-prop-2-enoxyaniline (PubChem CID 82152301) has the molecular formula C18H15FN2OS and a molecular weight of 326.40 g/mol. Its IUPAC name is 5-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2-prop-2-enoxyaniline.
| Compound Name | 5-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2-prop-2-enoxyaniline |
|---|---|
| PubChem CID | 82152301 |
| Molecular Formula | C18H15FN2OS |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 5-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2-prop-2-enoxyaniline |
| SMILES | C=CCOc1ccc(-c2nc(-c3ccc(F)cc3)cs2)cc1N |
| InChI | InChI=1S/C18H15FN2OS/c1-2-9-22-17-8-5-13(10-15(17)20)18-21-16(11-23-18)12-3-6-14(19)7-4-12/h2-8,10-11H,1,9,20H2 |
| InChIKey | MBTRGKLMTDHZEI-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|