C27H24N2O3S — CID 108761354
N-[[3-(4-phenyl-1,3-thiazol-2-yl)phenyl]methyl]-2-(2-prop-2-enoxyphenoxy)acetamide (PubChem CID 108761354) has the molecular formula C27H24N2O3S and a molecular weight of 456.57 g/mol. Its IUPAC name is N-[[3-(4-phenyl-1,3-thiazol-2-yl)phenyl]methyl]-2-(2-prop-2-enoxyphenoxy)acetamide.
| Compound Name | N-[[3-(4-phenyl-1,3-thiazol-2-yl)phenyl]methyl]-2-(2-prop-2-enoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 108761354 |
| Molecular Formula | C27H24N2O3S |
| Molecular Weight | 456.57 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | N-[[3-(4-phenyl-1,3-thiazol-2-yl)phenyl]methyl]-2-(2-prop-2-enoxyphenoxy)acetamide |
| SMILES | C=CCOc1ccccc1OCC(=O)NCc1cccc(-c2nc(-c3ccccc3)cs2)c1 |
| InChI | InChI=1S/C27H24N2O3S/c1-2-15-31-24-13-6-7-14-25(24)32-18-26(30)28-17-20-9-8-12-22(16-20)27-29-23(19-33-27)21-10-4-3-5-11-21/h2-14,16,19H,1,15,17-18H2,(H,28,30) |
| InChIKey | ZTUSWNRETBMUBE-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.57 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|