C25H21N3O3S — CID 108770444
2-(2-prop-2-enoxyphenoxy)-N-[3-(2-pyridin-2-yl-1,3-thiazol-4-yl)phenyl]acetamide (PubChem CID 108770444) has the molecular formula C25H21N3O3S and a molecular weight of 443.53 g/mol. Its IUPAC name is 2-(2-prop-2-enoxyphenoxy)-N-[3-(2-pyridin-2-yl-1,3-thiazol-4-yl)phenyl]acetamide.
| Compound Name | 2-(2-prop-2-enoxyphenoxy)-N-[3-(2-pyridin-2-yl-1,3-thiazol-4-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 108770444 |
| Molecular Formula | C25H21N3O3S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | 2-(2-prop-2-enoxyphenoxy)-N-[3-(2-pyridin-2-yl-1,3-thiazol-4-yl)phenyl]acetamide |
| SMILES | C=CCOc1ccccc1OCC(=O)Nc1cccc(-c2csc(-c3ccccn3)n2)c1 |
| InChI | InChI=1S/C25H21N3O3S/c1-2-14-30-22-11-3-4-12-23(22)31-16-24(29)27-19-9-7-8-18(15-19)21-17-32-25(28-21)20-10-5-6-13-26-20/h2-13,15,17H,1,14,16H2,(H,27,29) |
| InChIKey | HBWMJNWEZVGXHX-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|