C27H24N2O2S — CID 108738573
5-oxo-5-phenyl-N-[[3-(4-phenyl-1,3-thiazol-2-yl)phenyl]methyl]pentanamide (PubChem CID 108738573) has the molecular formula C27H24N2O2S and a molecular weight of 440.57 g/mol. Its IUPAC name is 5-oxo-5-phenyl-N-[[3-(4-phenyl-1,3-thiazol-2-yl)phenyl]methyl]pentanamide.
| Compound Name | 5-oxo-5-phenyl-N-[[3-(4-phenyl-1,3-thiazol-2-yl)phenyl]methyl]pentanamide |
|---|---|
| PubChem CID | 108738573 |
| Molecular Formula | C27H24N2O2S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | 5-oxo-5-phenyl-N-[[3-(4-phenyl-1,3-thiazol-2-yl)phenyl]methyl]pentanamide |
| SMILES | O=C(CCCC(=O)c1ccccc1)NCc1cccc(-c2nc(-c3ccccc3)cs2)c1 |
| InChI | InChI=1S/C27H24N2O2S/c30-25(22-12-5-2-6-13-22)15-8-16-26(31)28-18-20-9-7-14-23(17-20)27-29-24(19-32-27)21-10-3-1-4-11-21/h1-7,9-14,17,19H,8,15-16,18H2,(H,28,31) |
| InChIKey | UHVJLBXXUGTRAU-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |