C24H26N2OS — CID 108761273
2-cyclohexyl-N-[[3-(4-phenyl-1,3-thiazol-2-yl)phenyl]methyl]acetamide (PubChem CID 108761273) has the molecular formula C24H26N2OS and a molecular weight of 390.55 g/mol. Its IUPAC name is 2-cyclohexyl-N-[[3-(4-phenyl-1,3-thiazol-2-yl)phenyl]methyl]acetamide.
| Compound Name | 2-cyclohexyl-N-[[3-(4-phenyl-1,3-thiazol-2-yl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 108761273 |
| Molecular Formula | C24H26N2OS |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 2-cyclohexyl-N-[[3-(4-phenyl-1,3-thiazol-2-yl)phenyl]methyl]acetamide |
| SMILES | O=C(CC1CCCCC1)NCc1cccc(-c2nc(-c3ccccc3)cs2)c1 |
| InChI | InChI=1S/C24H26N2OS/c27-23(15-18-8-3-1-4-9-18)25-16-19-10-7-13-21(14-19)24-26-22(17-28-24)20-11-5-2-6-12-20/h2,5-7,10-14,17-18H,1,3-4,8-9,15-16H2,(H,25,27) |
| InChIKey | AZDFKOLGPAYCDG-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |