C19H17FN2S — CID 5270991
N-[[4-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]phenyl]methyl]prop-2-en-1-amine (PubChem CID 5270991) has the molecular formula C19H17FN2S and a molecular weight of 324.42 g/mol. Its IUPAC name is N-[[4-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]phenyl]methyl]prop-2-en-1-amine.
| Compound Name | N-[[4-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]phenyl]methyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 5270991 |
| Molecular Formula | C19H17FN2S |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | N-[[4-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]phenyl]methyl]prop-2-en-1-amine |
| SMILES | C=CCNCc1ccc(-c2csc(-c3ccc(F)cc3)n2)cc1 |
| InChI | InChI=1S/C19H17FN2S/c1-2-11-21-12-14-3-5-15(6-4-14)18-13-23-19(22-18)16-7-9-17(20)10-8-16/h2-10,13,21H,1,11-12H2 |
| InChIKey | YJEHIHKDIZKRAR-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|