C20H19FN4 — CID 112933264
2-N-[(4-fluorophenyl)methyl]-6-phenyl-4-N-prop-2-enylpyrimidine-2,4-diamine (PubChem CID 112933264) has the molecular formula C20H19FN4 and a molecular weight of 334.40 g/mol. Its IUPAC name is 2-N-[(4-fluorophenyl)methyl]-6-phenyl-4-N-prop-2-enylpyrimidine-2,4-diamine.
| Compound Name | 2-N-[(4-fluorophenyl)methyl]-6-phenyl-4-N-prop-2-enylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112933264 |
| Molecular Formula | C20H19FN4 |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 2-N-[(4-fluorophenyl)methyl]-6-phenyl-4-N-prop-2-enylpyrimidine-2,4-diamine |
| SMILES | C=CCNc1cc(-c2ccccc2)nc(NCc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C20H19FN4/c1-2-12-22-19-13-18(16-6-4-3-5-7-16)24-20(25-19)23-14-15-8-10-17(21)11-9-15/h2-11,13H,1,12,14H2,(H2,22,23,24,25) |
| InChIKey | CSSIIYXUCNJMDN-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|