C19H25N5O — CID 112933250
2-N-(2-morpholin-4-ylethyl)-6-phenyl-4-N-prop-2-enylpyrimidine-2,4-diamine (PubChem CID 112933250) has the molecular formula C19H25N5O and a molecular weight of 339.44 g/mol. Its IUPAC name is 2-N-(2-morpholin-4-ylethyl)-6-phenyl-4-N-prop-2-enylpyrimidine-2,4-diamine.
| Compound Name | 2-N-(2-morpholin-4-ylethyl)-6-phenyl-4-N-prop-2-enylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112933250 |
| Molecular Formula | C19H25N5O |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.21 |
| IUPAC Name | 2-N-(2-morpholin-4-ylethyl)-6-phenyl-4-N-prop-2-enylpyrimidine-2,4-diamine |
| SMILES | C=CCNc1cc(-c2ccccc2)nc(NCCN2CCOCC2)n1 |
| InChI | InChI=1S/C19H25N5O/c1-2-8-20-18-15-17(16-6-4-3-5-7-16)22-19(23-18)21-9-10-24-11-13-25-14-12-24/h2-7,15H,1,8-14H2,(H2,20,21,22,23) |
| InChIKey | UJEVNEFMEXCQTK-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|