C21H21ClN4 — CID 112933289
2-N-[2-(4-chlorophenyl)ethyl]-6-phenyl-4-N-prop-2-enylpyrimidine-2,4-diamine (PubChem CID 112933289) has the molecular formula C21H21ClN4 and a molecular weight of 364.88 g/mol. Its IUPAC name is 2-N-[2-(4-chlorophenyl)ethyl]-6-phenyl-4-N-prop-2-enylpyrimidine-2,4-diamine.
| Compound Name | 2-N-[2-(4-chlorophenyl)ethyl]-6-phenyl-4-N-prop-2-enylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112933289 |
| Molecular Formula | C21H21ClN4 |
| Molecular Weight | 364.88 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 2-N-[2-(4-chlorophenyl)ethyl]-6-phenyl-4-N-prop-2-enylpyrimidine-2,4-diamine |
| SMILES | C=CCNc1cc(-c2ccccc2)nc(NCCc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C21H21ClN4/c1-2-13-23-20-15-19(17-6-4-3-5-7-17)25-21(26-20)24-14-12-16-8-10-18(22)11-9-16/h2-11,15H,1,12-14H2,(H2,23,24,25,26) |
| InChIKey | YLVLCFNKBCPPTB-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.88 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|