C21H21ClN4O2 — CID 112933524
4-N-(4-chloro-2,5-dimethoxyphenyl)-6-phenyl-2-N-prop-2-enylpyrimidine-2,4-diamine (PubChem CID 112933524) has the molecular formula C21H21ClN4O2 and a molecular weight of 396.88 g/mol. Its IUPAC name is 4-N-(4-chloro-2,5-dimethoxyphenyl)-6-phenyl-2-N-prop-2-enylpyrimidine-2,4-diamine.
| Compound Name | 4-N-(4-chloro-2,5-dimethoxyphenyl)-6-phenyl-2-N-prop-2-enylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112933524 |
| Molecular Formula | C21H21ClN4O2 |
| Molecular Weight | 396.88 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 4-N-(4-chloro-2,5-dimethoxyphenyl)-6-phenyl-2-N-prop-2-enylpyrimidine-2,4-diamine |
| SMILES | C=CCNc1nc(Nc2cc(OC)c(Cl)cc2OC)cc(-c2ccccc2)n1 |
| InChI | InChI=1S/C21H21ClN4O2/c1-4-10-23-21-25-16(14-8-6-5-7-9-14)13-20(26-21)24-17-12-18(27-2)15(22)11-19(17)28-3/h4-9,11-13H,1,10H2,2-3H3,(H2,23,24,25,26) |
| InChIKey | UBHGYHZHLAKDNB-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.88 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|