C15H17ClN4 — CID 112907715
2-N-[(4-chlorophenyl)methyl]-6-methyl-4-N-prop-2-enylpyrimidine-2,4-diamine (PubChem CID 112907715) has the molecular formula C15H17ClN4 and a molecular weight of 288.78 g/mol. Its IUPAC name is 2-N-[(4-chlorophenyl)methyl]-6-methyl-4-N-prop-2-enylpyrimidine-2,4-diamine.
| Compound Name | 2-N-[(4-chlorophenyl)methyl]-6-methyl-4-N-prop-2-enylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112907715 |
| Molecular Formula | C15H17ClN4 |
| Molecular Weight | 288.78 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 2-N-[(4-chlorophenyl)methyl]-6-methyl-4-N-prop-2-enylpyrimidine-2,4-diamine |
| SMILES | C=CCNc1cc(C)nc(NCc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C15H17ClN4/c1-3-8-17-14-9-11(2)19-15(20-14)18-10-12-4-6-13(16)7-5-12/h3-7,9H,1,8,10H2,2H3,(H2,17,18,19,20) |
| InChIKey | WTBLSOHXSOQXTO-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.78 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|