C13H14Cl2N3- — CID 53351957
N-[(4-chlorophenyl)methyl]-4,6-dimethylpyrimidin-2-amine chloride (PubChem CID 53351957) has the molecular formula C13H14Cl2N3- and a molecular weight of 283.18 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-4,6-dimethylpyrimidin-2-amine chloride.
| Compound Name | N-[(4-chlorophenyl)methyl]-4,6-dimethylpyrimidin-2-amine chloride |
|---|---|
| PubChem CID | 53351957 |
| Molecular Formula | C13H14Cl2N3- |
| Molecular Weight | 283.18 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-4,6-dimethylpyrimidin-2-amine chloride |
| SMILES | Cc1cc(C)nc(NCc2ccc(Cl)cc2)n1.[Cl-] |
| InChI | InChI=1S/C13H14ClN3.ClH/c1-9-7-10(2)17-13(16-9)15-8-11-3-5-12(14)6-4-11;/h3-7H,8H2,1-2H3,(H,15,16,17);1H/p-1 |
| InChIKey | ZXBATMCSYNKHDV-UHFFFAOYSA-M |
| XLogP | 0.36 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.18 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |