C20H22ClN7 — CID 112918088
N-[(4-chlorophenyl)methyl]-4-methyl-6-(4-pyrimidin-2-ylpiperazin-1-yl)pyrimidin-2-amine (PubChem CID 112918088) has the molecular formula C20H22ClN7 and a molecular weight of 395.90 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-4-methyl-6-(4-pyrimidin-2-ylpiperazin-1-yl)pyrimidin-2-amine.
| Compound Name | N-[(4-chlorophenyl)methyl]-4-methyl-6-(4-pyrimidin-2-ylpiperazin-1-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 112918088 |
| Molecular Formula | C20H22ClN7 |
| Molecular Weight | 395.90 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-4-methyl-6-(4-pyrimidin-2-ylpiperazin-1-yl)pyrimidin-2-amine |
| SMILES | Cc1cc(N2CCN(c3ncccn3)CC2)nc(NCc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C20H22ClN7/c1-15-13-18(26-19(25-15)24-14-16-3-5-17(21)6-4-16)27-9-11-28(12-10-27)20-22-7-2-8-23-20/h2-8,13H,9-12,14H2,1H3,(H,24,25,26) |
| InChIKey | YEXLDSLBFFTMSK-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.90 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |