C20H21ClN6 — CID 112891904
N-[(4-chlorophenyl)methyl]-2-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-4-amine (PubChem CID 112891904) has the molecular formula C20H21ClN6 and a molecular weight of 380.88 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-4-amine.
| Compound Name | N-[(4-chlorophenyl)methyl]-2-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 112891904 |
| Molecular Formula | C20H21ClN6 |
| Molecular Weight | 380.88 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-2-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-4-amine |
| SMILES | Clc1ccc(CNc2ccnc(N3CCN(c4ccccn4)CC3)n2)cc1 |
| InChI | InChI=1S/C20H21ClN6/c21-17-6-4-16(5-7-17)15-24-18-8-10-23-20(25-18)27-13-11-26(12-14-27)19-3-1-2-9-22-19/h1-10H,11-15H2,(H,23,24,25) |
| InChIKey | ZHGMUGPWKKYBAG-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.88 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |