C16H20FN5 — CID 112888087
N-[(4-fluorophenyl)methyl]-2-(4-methylpiperazin-1-yl)pyrimidin-4-amine (PubChem CID 112888087) has the molecular formula C16H20FN5 and a molecular weight of 301.37 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-2-(4-methylpiperazin-1-yl)pyrimidin-4-amine.
| Compound Name | N-[(4-fluorophenyl)methyl]-2-(4-methylpiperazin-1-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 112888087 |
| Molecular Formula | C16H20FN5 |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-2-(4-methylpiperazin-1-yl)pyrimidin-4-amine |
| SMILES | CN1CCN(c2nccc(NCc3ccc(F)cc3)n2)CC1 |
| InChI | InChI=1S/C16H20FN5/c1-21-8-10-22(11-9-21)16-18-7-6-15(20-16)19-12-13-2-4-14(17)5-3-13/h2-7H,8-12H2,1H3,(H,18,19,20) |
| InChIKey | MYLWWTMCWHFNLI-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |