C22H24ClN5 — CID 54582423
N-benzyl-2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]pyrimidin-4-amine (PubChem CID 54582423) has the molecular formula C22H24ClN5 and a molecular weight of 393.92 g/mol. Its IUPAC name is N-benzyl-2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]pyrimidin-4-amine.
| Compound Name | N-benzyl-2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 54582423 |
| Molecular Formula | C22H24ClN5 |
| Molecular Weight | 393.92 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | N-benzyl-2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]pyrimidin-4-amine |
| SMILES | Clc1ccc(CN2CCN(c3nccc(NCc4ccccc4)n3)CC2)cc1 |
| InChI | InChI=1S/C22H24ClN5/c23-20-8-6-19(7-9-20)17-27-12-14-28(15-13-27)22-24-11-10-21(26-22)25-16-18-4-2-1-3-5-18/h1-11H,12-17H2,(H,24,25,26) |
| InChIKey | KVNDUVHFPYTHQS-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.92 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |