C20H27N5 — CID 112884158
2-(4-benzylpiperazin-1-yl)-N-cyclopentylpyrimidin-4-amine (PubChem CID 112884158) has the molecular formula C20H27N5 and a molecular weight of 337.47 g/mol. Its IUPAC name is 2-(4-benzylpiperazin-1-yl)-N-cyclopentylpyrimidin-4-amine.
| Compound Name | 2-(4-benzylpiperazin-1-yl)-N-cyclopentylpyrimidin-4-amine |
|---|---|
| PubChem CID | 112884158 |
| Molecular Formula | C20H27N5 |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | 2-(4-benzylpiperazin-1-yl)-N-cyclopentylpyrimidin-4-amine |
| SMILES | c1ccc(CN2CCN(c3nccc(NC4CCCC4)n3)CC2)cc1 |
| InChI | InChI=1S/C20H27N5/c1-2-6-17(7-3-1)16-24-12-14-25(15-13-24)20-21-11-10-19(23-20)22-18-8-4-5-9-18/h1-3,6-7,10-11,18H,4-5,8-9,12-16H2,(H,21,22,23) |
| InChIKey | OHUSSHRTYPQEHZ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |