C36H45N9 — CID 3393793
2,4,6-tris(4-benzylpiperazin-1-yl)-1,3,5-triazine (PubChem CID 3393793) has the molecular formula C36H45N9 and a molecular weight of 603.82 g/mol. Its IUPAC name is 2,4,6-tris(4-benzylpiperazin-1-yl)-1,3,5-triazine.
| Compound Name | 2,4,6-tris(4-benzylpiperazin-1-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 3393793 |
| Molecular Formula | C36H45N9 |
| Molecular Weight | 603.82 g/mol |
| Exact Mass | 603.38 |
| IUPAC Name | 2,4,6-tris(4-benzylpiperazin-1-yl)-1,3,5-triazine |
| SMILES | c1ccc(CN2CCN(c3nc(N4CCN(Cc5ccccc5)CC4)nc(N4CCN(Cc5ccccc5)CC4)n3)CC2)cc1 |
| InChI | InChI=1S/C36H45N9/c1-4-10-31(11-5-1)28-40-16-22-43(23-17-40)34-37-35(44-24-18-41(19-25-44)29-32-12-6-2-7-13-32)39-36(38-34)45-26-20-42(21-27-45)30-33-14-8-3-9-15-33/h1-15H,16-30H2 |
| InChIKey | DQJWJYQCLPOYNC-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 58.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.82 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |