C22H31N5 — CID 112922137
1-[2-(4-benzylpiperazin-1-yl)-6-methylpyrimidin-4-yl]azepane (PubChem CID 112922137) has the molecular formula C22H31N5 and a molecular weight of 365.52 g/mol. Its IUPAC name is 1-[2-(4-benzylpiperazin-1-yl)-6-methylpyrimidin-4-yl]azepane.
| Compound Name | 1-[2-(4-benzylpiperazin-1-yl)-6-methylpyrimidin-4-yl]azepane |
|---|---|
| PubChem CID | 112922137 |
| Molecular Formula | C22H31N5 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.26 |
| IUPAC Name | 1-[2-(4-benzylpiperazin-1-yl)-6-methylpyrimidin-4-yl]azepane |
| SMILES | Cc1cc(N2CCCCCC2)nc(N2CCN(Cc3ccccc3)CC2)n1 |
| InChI | InChI=1S/C22H31N5/c1-19-17-21(26-11-7-2-3-8-12-26)24-22(23-19)27-15-13-25(14-16-27)18-20-9-5-4-6-10-20/h4-6,9-10,17H,2-3,7-8,11-16,18H2,1H3 |
| InChIKey | UIHYHTMVVCUIET-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 35.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |