C21H29N5 — CID 112922182
1-[4-methyl-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]azepane (PubChem CID 112922182) has the molecular formula C21H29N5 and a molecular weight of 351.50 g/mol. Its IUPAC name is 1-[4-methyl-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]azepane.
| Compound Name | 1-[4-methyl-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]azepane |
|---|---|
| PubChem CID | 112922182 |
| Molecular Formula | C21H29N5 |
| Molecular Weight | 351.50 g/mol |
| Exact Mass | 351.24 |
| IUPAC Name | 1-[4-methyl-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]azepane |
| SMILES | Cc1cc(N2CCN(c3ccccc3)CC2)nc(N2CCCCCC2)n1 |
| InChI | InChI=1S/C21H29N5/c1-18-17-20(23-21(22-18)26-11-7-2-3-8-12-26)25-15-13-24(14-16-25)19-9-5-4-6-10-19/h4-6,9-10,17H,2-3,7-8,11-16H2,1H3 |
| InChIKey | DZXSMTVPXSSOTM-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 35.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.50 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |