C16H21ClN4 — CID 16805641
2,4-dimethyl-6-(4-phenylpiperazin-1-yl)pyrimidine;hydrochloride (PubChem CID 16805641) has the molecular formula C16H21ClN4 and a molecular weight of 304.83 g/mol. Its IUPAC name is 2,4-dimethyl-6-(4-phenylpiperazin-1-yl)pyrimidine;hydrochloride.
| Compound Name | 2,4-dimethyl-6-(4-phenylpiperazin-1-yl)pyrimidine;hydrochloride |
|---|---|
| PubChem CID | 16805641 |
| Molecular Formula | C16H21ClN4 |
| Molecular Weight | 304.83 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 2,4-dimethyl-6-(4-phenylpiperazin-1-yl)pyrimidine;hydrochloride |
| SMILES | Cc1cc(N2CCN(c3ccccc3)CC2)nc(C)n1.Cl |
| InChI | InChI=1S/C16H20N4.ClH/c1-13-12-16(18-14(2)17-13)20-10-8-19(9-11-20)15-6-4-3-5-7-15;/h3-7,12H,8-11H2,1-2H3;1H |
| InChIKey | DDGMEFKZSGZIPQ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.83 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |