C21H28N6O — CID 109366887
[2-methyl-6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]-(4-phenylpiperazin-1-yl)methanone (PubChem CID 109366887) has the molecular formula C21H28N6O and a molecular weight of 380.50 g/mol. Its IUPAC name is [2-methyl-6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]-(4-phenylpiperazin-1-yl)methanone.
| Compound Name | [2-methyl-6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]-(4-phenylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 109366887 |
| Molecular Formula | C21H28N6O |
| Molecular Weight | 380.50 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | [2-methyl-6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]-(4-phenylpiperazin-1-yl)methanone |
| SMILES | Cc1nc(C(=O)N2CCN(c3ccccc3)CC2)cc(N2CCN(C)CC2)n1 |
| InChI | InChI=1S/C21H28N6O/c1-17-22-19(16-20(23-17)26-10-8-24(2)9-11-26)21(28)27-14-12-25(13-15-27)18-6-4-3-5-7-18/h3-7,16H,8-15H2,1-2H3 |
| InChIKey | MTCQVAQBSYOPEI-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 55.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.50 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |