C20H26N6O — CID 109116154
[6-(4-methylpiperazin-1-yl)pyridazin-3-yl]-(4-phenylpiperazin-1-yl)methanone (PubChem CID 109116154) has the molecular formula C20H26N6O and a molecular weight of 366.47 g/mol. Its IUPAC name is [6-(4-methylpiperazin-1-yl)pyridazin-3-yl]-(4-phenylpiperazin-1-yl)methanone.
| Compound Name | [6-(4-methylpiperazin-1-yl)pyridazin-3-yl]-(4-phenylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 109116154 |
| Molecular Formula | C20H26N6O |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | [6-(4-methylpiperazin-1-yl)pyridazin-3-yl]-(4-phenylpiperazin-1-yl)methanone |
| SMILES | CN1CCN(c2ccc(C(=O)N3CCN(c4ccccc4)CC3)nn2)CC1 |
| InChI | InChI=1S/C20H26N6O/c1-23-9-11-25(12-10-23)19-8-7-18(21-22-19)20(27)26-15-13-24(14-16-26)17-5-3-2-4-6-17/h2-8H,9-16H2,1H3 |
| InChIKey | ZTEYMCCRUNRKIC-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 55.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |