C14H21N5O — CID 109111898
[6-(4-methylpiperazin-1-yl)pyridazin-3-yl]-pyrrolidin-1-ylmethanone (PubChem CID 109111898) has the molecular formula C14H21N5O and a molecular weight of 275.36 g/mol. Its IUPAC name is [6-(4-methylpiperazin-1-yl)pyridazin-3-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [6-(4-methylpiperazin-1-yl)pyridazin-3-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 109111898 |
| Molecular Formula | C14H21N5O |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | [6-(4-methylpiperazin-1-yl)pyridazin-3-yl]-pyrrolidin-1-ylmethanone |
| SMILES | CN1CCN(c2ccc(C(=O)N3CCCC3)nn2)CC1 |
| InChI | InChI=1S/C14H21N5O/c1-17-8-10-18(11-9-17)13-5-4-12(15-16-13)14(20)19-6-2-3-7-19/h4-5H,2-3,6-11H2,1H3 |
| InChIKey | UINCLKLCCGBMHN-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |