C18H23N7O — CID 121027881
[4-(6-methylpyridazin-3-yl)piperazin-1-yl]-(6-pyrrolidin-1-ylpyridazin-3-yl)methanone (PubChem CID 121027881) has the molecular formula C18H23N7O and a molecular weight of 353.43 g/mol. Its IUPAC name is [4-(6-methylpyridazin-3-yl)piperazin-1-yl]-(6-pyrrolidin-1-ylpyridazin-3-yl)methanone.
| Compound Name | [4-(6-methylpyridazin-3-yl)piperazin-1-yl]-(6-pyrrolidin-1-ylpyridazin-3-yl)methanone |
|---|---|
| PubChem CID | 121027881 |
| Molecular Formula | C18H23N7O |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | [4-(6-methylpyridazin-3-yl)piperazin-1-yl]-(6-pyrrolidin-1-ylpyridazin-3-yl)methanone |
| SMILES | Cc1ccc(N2CCN(C(=O)c3ccc(N4CCCC4)nn3)CC2)nn1 |
| InChI | InChI=1S/C18H23N7O/c1-14-4-6-16(21-19-14)24-10-12-25(13-11-24)18(26)15-5-7-17(22-20-15)23-8-2-3-9-23/h4-7H,2-3,8-13H2,1H3 |
| InChIKey | DGVBMJDIWMWAQM-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 78.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |