C21H27IN6O — CID 122341241
(2-iodophenyl)-[4-[2-methyl-6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]piperazin-1-yl]methanone (PubChem CID 122341241) has the molecular formula C21H27IN6O and a molecular weight of 506.39 g/mol. Its IUPAC name is (2-iodophenyl)-[4-[2-methyl-6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]piperazin-1-yl]methanone.
| Compound Name | (2-iodophenyl)-[4-[2-methyl-6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 122341241 |
| Molecular Formula | C21H27IN6O |
| Molecular Weight | 506.39 g/mol |
| Exact Mass | 506.13 |
| IUPAC Name | (2-iodophenyl)-[4-[2-methyl-6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]piperazin-1-yl]methanone |
| SMILES | Cc1nc(N2CCN(C)CC2)cc(N2CCN(C(=O)c3ccccc3I)CC2)n1 |
| InChI | InChI=1S/C21H27IN6O/c1-16-23-19(26-9-7-25(2)8-10-26)15-20(24-16)27-11-13-28(14-12-27)21(29)17-5-3-4-6-18(17)22/h3-6,15H,7-14H2,1-2H3 |
| InChIKey | APEWGHUCCRJJAC-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 55.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.39 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|