C16H17IN4O — CID 108755287
(2-iodophenyl)-[4-(6-methylpyrimidin-4-yl)piperazin-1-yl]methanone (PubChem CID 108755287) has the molecular formula C16H17IN4O and a molecular weight of 408.24 g/mol. Its IUPAC name is (2-iodophenyl)-[4-(6-methylpyrimidin-4-yl)piperazin-1-yl]methanone.
| Compound Name | (2-iodophenyl)-[4-(6-methylpyrimidin-4-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 108755287 |
| Molecular Formula | C16H17IN4O |
| Molecular Weight | 408.24 g/mol |
| Exact Mass | 408.04 |
| IUPAC Name | (2-iodophenyl)-[4-(6-methylpyrimidin-4-yl)piperazin-1-yl]methanone |
| SMILES | Cc1cc(N2CCN(C(=O)c3ccccc3I)CC2)ncn1 |
| InChI | InChI=1S/C16H17IN4O/c1-12-10-15(19-11-18-12)20-6-8-21(9-7-20)16(22)13-4-2-3-5-14(13)17/h2-5,10-11H,6-9H2,1H3 |
| InChIKey | ZVROLBJRLQDLOP-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.24 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|