C17H19IN4O2 — CID 134279332
[2-(2,6-dimethylpyrimidin-4-yl)-1,2,5-oxadiazepan-5-yl]-(2-iodophenyl)methanone (PubChem CID 134279332) has the molecular formula C17H19IN4O2 and a molecular weight of 438.27 g/mol. Its IUPAC name is [2-(2,6-dimethylpyrimidin-4-yl)-1,2,5-oxadiazepan-5-yl]-(2-iodophenyl)methanone.
| Compound Name | [2-(2,6-dimethylpyrimidin-4-yl)-1,2,5-oxadiazepan-5-yl]-(2-iodophenyl)methanone |
|---|---|
| PubChem CID | 134279332 |
| Molecular Formula | C17H19IN4O2 |
| Molecular Weight | 438.27 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | [2-(2,6-dimethylpyrimidin-4-yl)-1,2,5-oxadiazepan-5-yl]-(2-iodophenyl)methanone |
| SMILES | Cc1cc(N2CCN(C(=O)c3ccccc3I)CCO2)nc(C)n1 |
| InChI | InChI=1S/C17H19IN4O2/c1-12-11-16(20-13(2)19-12)22-8-7-21(9-10-24-22)17(23)14-5-3-4-6-15(14)18/h3-6,11H,7-10H2,1-2H3 |
| InChIKey | WNNVUZIKRWPZFJ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.27 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|