C19H23IN4O — CID 44582810
(2-iodophenyl)-[4-[(3,5,6-trimethylpyrazin-2-yl)methyl]piperazin-1-yl]methanone (PubChem CID 44582810) has the molecular formula C19H23IN4O and a molecular weight of 450.32 g/mol. Its IUPAC name is (2-iodophenyl)-[4-[(3,5,6-trimethylpyrazin-2-yl)methyl]piperazin-1-yl]methanone.
| Compound Name | (2-iodophenyl)-[4-[(3,5,6-trimethylpyrazin-2-yl)methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 44582810 |
| Molecular Formula | C19H23IN4O |
| Molecular Weight | 450.32 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | (2-iodophenyl)-[4-[(3,5,6-trimethylpyrazin-2-yl)methyl]piperazin-1-yl]methanone |
| SMILES | Cc1nc(C)c(CN2CCN(C(=O)c3ccccc3I)CC2)nc1C |
| InChI | InChI=1S/C19H23IN4O/c1-13-14(2)22-18(15(3)21-13)12-23-8-10-24(11-9-23)19(25)16-6-4-5-7-17(16)20/h4-7H,8-12H2,1-3H3 |
| InChIKey | UBEUIDJVSWHKPD-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.32 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|