C15H17IN4OS — CID 133333033
[4-(3-ethyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]-(2-iodophenyl)methanone (PubChem CID 133333033) has the molecular formula C15H17IN4OS and a molecular weight of 428.30 g/mol. Its IUPAC name is [4-(3-ethyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]-(2-iodophenyl)methanone.
| Compound Name | [4-(3-ethyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]-(2-iodophenyl)methanone |
|---|---|
| PubChem CID | 133333033 |
| Molecular Formula | C15H17IN4OS |
| Molecular Weight | 428.30 g/mol |
| Exact Mass | 428.02 |
| IUPAC Name | [4-(3-ethyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]-(2-iodophenyl)methanone |
| SMILES | CCc1nsc(N2CCN(C(=O)c3ccccc3I)CC2)n1 |
| InChI | InChI=1S/C15H17IN4OS/c1-2-13-17-15(22-18-13)20-9-7-19(8-10-20)14(21)11-5-3-4-6-12(11)16/h3-6H,2,7-10H2,1H3 |
| InChIKey | ZLKVWPQBOSSMFA-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.30 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|