C15H21Cl2N5OS — CID 119947337
(2-aminophenyl)-[4-(3-ethyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]methanone;dihydrochloride (PubChem CID 119947337) has the molecular formula C15H21Cl2N5OS and a molecular weight of 390.34 g/mol. Its IUPAC name is (2-aminophenyl)-[4-(3-ethyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]methanone;dihydrochloride.
| Compound Name | (2-aminophenyl)-[4-(3-ethyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]methanone;dihydrochloride |
|---|---|
| PubChem CID | 119947337 |
| Molecular Formula | C15H21Cl2N5OS |
| Molecular Weight | 390.34 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | (2-aminophenyl)-[4-(3-ethyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]methanone;dihydrochloride |
| SMILES | CCc1nsc(N2CCN(C(=O)c3ccccc3N)CC2)n1.Cl.Cl |
| InChI | InChI=1S/C15H19N5OS.2ClH/c1-2-13-17-15(22-18-13)20-9-7-19(8-10-20)14(21)11-5-3-4-6-12(11)16;;/h3-6H,2,7-10,16H2,1H3;2*1H |
| InChIKey | OQEQJZIJPDDJQF-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.34 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|