C20H20IN3OS — CID 41027410
[4-(4,5-dimethyl-1,3-benzothiazol-2-yl)piperazin-1-yl]-(2-iodophenyl)methanone (PubChem CID 41027410) has the molecular formula C20H20IN3OS and a molecular weight of 477.37 g/mol. Its IUPAC name is [4-(4,5-dimethyl-1,3-benzothiazol-2-yl)piperazin-1-yl]-(2-iodophenyl)methanone.
| Compound Name | [4-(4,5-dimethyl-1,3-benzothiazol-2-yl)piperazin-1-yl]-(2-iodophenyl)methanone |
|---|---|
| PubChem CID | 41027410 |
| Molecular Formula | C20H20IN3OS |
| Molecular Weight | 477.37 g/mol |
| Exact Mass | 477.04 |
| IUPAC Name | [4-(4,5-dimethyl-1,3-benzothiazol-2-yl)piperazin-1-yl]-(2-iodophenyl)methanone |
| SMILES | Cc1ccc2sc(N3CCN(C(=O)c4ccccc4I)CC3)nc2c1C |
| InChI | InChI=1S/C20H20IN3OS/c1-13-7-8-17-18(14(13)2)22-20(26-17)24-11-9-23(10-12-24)19(25)15-5-3-4-6-16(15)21/h3-8H,9-12H2,1-2H3 |
| InChIKey | FDXTUPANWQTHJD-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.37 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|