C20H20IN3O2S — CID 41116780
(2-iodophenyl)-[4-(4-methoxy-7-methyl-1,3-benzothiazol-2-yl)piperazin-1-yl]methanone (PubChem CID 41116780) has the molecular formula C20H20IN3O2S and a molecular weight of 493.37 g/mol. Its IUPAC name is (2-iodophenyl)-[4-(4-methoxy-7-methyl-1,3-benzothiazol-2-yl)piperazin-1-yl]methanone.
| Compound Name | (2-iodophenyl)-[4-(4-methoxy-7-methyl-1,3-benzothiazol-2-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 41116780 |
| Molecular Formula | C20H20IN3O2S |
| Molecular Weight | 493.37 g/mol |
| Exact Mass | 493.03 |
| IUPAC Name | (2-iodophenyl)-[4-(4-methoxy-7-methyl-1,3-benzothiazol-2-yl)piperazin-1-yl]methanone |
| SMILES | COc1ccc(C)c2sc(N3CCN(C(=O)c4ccccc4I)CC3)nc12 |
| InChI | InChI=1S/C20H20IN3O2S/c1-13-7-8-16(26-2)17-18(13)27-20(22-17)24-11-9-23(10-12-24)19(25)14-5-3-4-6-15(14)21/h3-8H,9-12H2,1-2H3 |
| InChIKey | MZIOZACFSJHGRH-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.37 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|