C20H20IN3O3S — CID 41116919
[4-(4,5-dimethoxy-1,3-benzothiazol-2-yl)piperazin-1-yl]-(2-iodophenyl)methanone (PubChem CID 41116919) has the molecular formula C20H20IN3O3S and a molecular weight of 509.37 g/mol. Its IUPAC name is [4-(4,5-dimethoxy-1,3-benzothiazol-2-yl)piperazin-1-yl]-(2-iodophenyl)methanone.
| Compound Name | [4-(4,5-dimethoxy-1,3-benzothiazol-2-yl)piperazin-1-yl]-(2-iodophenyl)methanone |
|---|---|
| PubChem CID | 41116919 |
| Molecular Formula | C20H20IN3O3S |
| Molecular Weight | 509.37 g/mol |
| Exact Mass | 509.03 |
| IUPAC Name | [4-(4,5-dimethoxy-1,3-benzothiazol-2-yl)piperazin-1-yl]-(2-iodophenyl)methanone |
| SMILES | COc1ccc2sc(N3CCN(C(=O)c4ccccc4I)CC3)nc2c1OC |
| InChI | InChI=1S/C20H20IN3O3S/c1-26-15-7-8-16-17(18(15)27-2)22-20(28-16)24-11-9-23(10-12-24)19(25)13-5-3-4-6-14(13)21/h3-8H,9-12H2,1-2H3 |
| InChIKey | UKJJSJJVXHPIDY-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.37 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|