C23H27N5 — CID 112873690
2-methyl-N-(2-phenylethyl)-6-(4-phenylpiperazin-1-yl)pyrimidin-4-amine (PubChem CID 112873690) has the molecular formula C23H27N5 and a molecular weight of 373.50 g/mol. Its IUPAC name is 2-methyl-N-(2-phenylethyl)-6-(4-phenylpiperazin-1-yl)pyrimidin-4-amine.
| Compound Name | 2-methyl-N-(2-phenylethyl)-6-(4-phenylpiperazin-1-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 112873690 |
| Molecular Formula | C23H27N5 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | 2-methyl-N-(2-phenylethyl)-6-(4-phenylpiperazin-1-yl)pyrimidin-4-amine |
| SMILES | Cc1nc(NCCc2ccccc2)cc(N2CCN(c3ccccc3)CC2)n1 |
| InChI | InChI=1S/C23H27N5/c1-19-25-22(24-13-12-20-8-4-2-5-9-20)18-23(26-19)28-16-14-27(15-17-28)21-10-6-3-7-11-21/h2-11,18H,12-17H2,1H3,(H,24,25,26) |
| InChIKey | BKMOZOUJJZOXIY-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |