C19H25ClN4 — CID 112874928
6-(azepan-1-yl)-N-[2-(4-chlorophenyl)ethyl]-2-methylpyrimidin-4-amine (PubChem CID 112874928) has the molecular formula C19H25ClN4 and a molecular weight of 344.89 g/mol. Its IUPAC name is 6-(azepan-1-yl)-N-[2-(4-chlorophenyl)ethyl]-2-methylpyrimidin-4-amine.
| Compound Name | 6-(azepan-1-yl)-N-[2-(4-chlorophenyl)ethyl]-2-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 112874928 |
| Molecular Formula | C19H25ClN4 |
| Molecular Weight | 344.89 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 6-(azepan-1-yl)-N-[2-(4-chlorophenyl)ethyl]-2-methylpyrimidin-4-amine |
| SMILES | Cc1nc(NCCc2ccc(Cl)cc2)cc(N2CCCCCC2)n1 |
| InChI | InChI=1S/C19H25ClN4/c1-15-22-18(21-11-10-16-6-8-17(20)9-7-16)14-19(23-15)24-12-4-2-3-5-13-24/h6-9,14H,2-5,10-13H2,1H3,(H,21,22,23) |
| InChIKey | JMQFWVFYBBLQKH-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.89 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |