C16H19ClN4 — CID 112883847
N-[2-(4-chlorophenyl)ethyl]-4-pyrrolidin-1-ylpyrimidin-2-amine (PubChem CID 112883847) has the molecular formula C16H19ClN4 and a molecular weight of 302.81 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)ethyl]-4-pyrrolidin-1-ylpyrimidin-2-amine.
| Compound Name | N-[2-(4-chlorophenyl)ethyl]-4-pyrrolidin-1-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 112883847 |
| Molecular Formula | C16H19ClN4 |
| Molecular Weight | 302.81 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | N-[2-(4-chlorophenyl)ethyl]-4-pyrrolidin-1-ylpyrimidin-2-amine |
| SMILES | Clc1ccc(CCNc2nccc(N3CCCC3)n2)cc1 |
| InChI | InChI=1S/C16H19ClN4/c17-14-5-3-13(4-6-14)7-9-18-16-19-10-8-15(20-16)21-11-1-2-12-21/h3-6,8,10H,1-2,7,9,11-12H2,(H,18,19,20) |
| InChIKey | STZJSMOXJRTESE-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.81 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |