C17H21ClN4 — CID 112884508
N-[2-(3-chlorophenyl)ethyl]-4-piperidin-1-ylpyrimidin-2-amine (PubChem CID 112884508) has the molecular formula C17H21ClN4 and a molecular weight of 316.84 g/mol. Its IUPAC name is N-[2-(3-chlorophenyl)ethyl]-4-piperidin-1-ylpyrimidin-2-amine.
| Compound Name | N-[2-(3-chlorophenyl)ethyl]-4-piperidin-1-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 112884508 |
| Molecular Formula | C17H21ClN4 |
| Molecular Weight | 316.84 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | N-[2-(3-chlorophenyl)ethyl]-4-piperidin-1-ylpyrimidin-2-amine |
| SMILES | Clc1cccc(CCNc2nccc(N3CCCCC3)n2)c1 |
| InChI | InChI=1S/C17H21ClN4/c18-15-6-4-5-14(13-15)7-9-19-17-20-10-8-16(21-17)22-11-2-1-3-12-22/h4-6,8,10,13H,1-3,7,9,11-12H2,(H,19,20,21) |
| InChIKey | QXZUDRHXKBBQAC-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.84 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |