C16H21ClN4 — CID 112897132
4-N-tert-butyl-2-N-[2-(4-chlorophenyl)ethyl]pyrimidine-2,4-diamine (PubChem CID 112897132) has the molecular formula C16H21ClN4 and a molecular weight of 304.82 g/mol. Its IUPAC name is 4-N-tert-butyl-2-N-[2-(4-chlorophenyl)ethyl]pyrimidine-2,4-diamine.
| Compound Name | 4-N-tert-butyl-2-N-[2-(4-chlorophenyl)ethyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112897132 |
| Molecular Formula | C16H21ClN4 |
| Molecular Weight | 304.82 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 4-N-tert-butyl-2-N-[2-(4-chlorophenyl)ethyl]pyrimidine-2,4-diamine |
| SMILES | CC(C)(C)Nc1ccnc(NCCc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C16H21ClN4/c1-16(2,3)21-14-9-11-19-15(20-14)18-10-8-12-4-6-13(17)7-5-12/h4-7,9,11H,8,10H2,1-3H3,(H2,18,19,20,21) |
| InChIKey | UJTLQVAMBNLIAG-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.82 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |