C19H27N5 — CID 112867225
2-methyl-6-[4-(3-methylphenyl)piperazin-1-yl]-N-propylpyrimidin-4-amine (PubChem CID 112867225) has the molecular formula C19H27N5 and a molecular weight of 325.46 g/mol. Its IUPAC name is 2-methyl-6-[4-(3-methylphenyl)piperazin-1-yl]-N-propylpyrimidin-4-amine.
| Compound Name | 2-methyl-6-[4-(3-methylphenyl)piperazin-1-yl]-N-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 112867225 |
| Molecular Formula | C19H27N5 |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.23 |
| IUPAC Name | 2-methyl-6-[4-(3-methylphenyl)piperazin-1-yl]-N-propylpyrimidin-4-amine |
| SMILES | CCCNc1cc(N2CCN(c3cccc(C)c3)CC2)nc(C)n1 |
| InChI | InChI=1S/C19H27N5/c1-4-8-20-18-14-19(22-16(3)21-18)24-11-9-23(10-12-24)17-7-5-6-15(2)13-17/h5-7,13-14H,4,8-12H2,1-3H3,(H,20,21,22) |
| InChIKey | WCTDEWHYJPIUHF-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |