C22H31N5 — CID 112869024
N-cyclohexyl-2-methyl-6-[4-(3-methylphenyl)piperazin-1-yl]pyrimidin-4-amine (PubChem CID 112869024) has the molecular formula C22H31N5 and a molecular weight of 365.53 g/mol. Its IUPAC name is N-cyclohexyl-2-methyl-6-[4-(3-methylphenyl)piperazin-1-yl]pyrimidin-4-amine.
| Compound Name | N-cyclohexyl-2-methyl-6-[4-(3-methylphenyl)piperazin-1-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 112869024 |
| Molecular Formula | C22H31N5 |
| Molecular Weight | 365.53 g/mol |
| Exact Mass | 365.26 |
| IUPAC Name | N-cyclohexyl-2-methyl-6-[4-(3-methylphenyl)piperazin-1-yl]pyrimidin-4-amine |
| SMILES | Cc1cccc(N2CCN(c3cc(NC4CCCCC4)nc(C)n3)CC2)c1 |
| InChI | InChI=1S/C22H31N5/c1-17-7-6-10-20(15-17)26-11-13-27(14-12-26)22-16-21(23-18(2)24-22)25-19-8-4-3-5-9-19/h6-7,10,15-16,19H,3-5,8-9,11-14H2,1-2H3,(H,23,24,25) |
| InChIKey | KXNTZVBVFQHZLT-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.53 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |