C20H26ClN5 — CID 112909661
2-[4-(3-chlorophenyl)piperazin-1-yl]-N-cyclopentyl-6-methylpyrimidin-4-amine (PubChem CID 112909661) has the molecular formula C20H26ClN5 and a molecular weight of 371.92 g/mol. Its IUPAC name is 2-[4-(3-chlorophenyl)piperazin-1-yl]-N-cyclopentyl-6-methylpyrimidin-4-amine.
| Compound Name | 2-[4-(3-chlorophenyl)piperazin-1-yl]-N-cyclopentyl-6-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 112909661 |
| Molecular Formula | C20H26ClN5 |
| Molecular Weight | 371.92 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | 2-[4-(3-chlorophenyl)piperazin-1-yl]-N-cyclopentyl-6-methylpyrimidin-4-amine |
| SMILES | Cc1cc(NC2CCCC2)nc(N2CCN(c3cccc(Cl)c3)CC2)n1 |
| InChI | InChI=1S/C20H26ClN5/c1-15-13-19(23-17-6-2-3-7-17)24-20(22-15)26-11-9-25(10-12-26)18-8-4-5-16(21)14-18/h4-5,8,13-14,17H,2-3,6-7,9-12H2,1H3,(H,22,23,24) |
| InChIKey | WFVIYEYFCZOWTA-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.92 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |