C19H26ClN5 — CID 112908525
2-[4-(3-chlorophenyl)piperazin-1-yl]-6-methyl-N-(2-methylpropyl)pyrimidin-4-amine (PubChem CID 112908525) has the molecular formula C19H26ClN5 and a molecular weight of 359.91 g/mol. Its IUPAC name is 2-[4-(3-chlorophenyl)piperazin-1-yl]-6-methyl-N-(2-methylpropyl)pyrimidin-4-amine.
| Compound Name | 2-[4-(3-chlorophenyl)piperazin-1-yl]-6-methyl-N-(2-methylpropyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 112908525 |
| Molecular Formula | C19H26ClN5 |
| Molecular Weight | 359.91 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | 2-[4-(3-chlorophenyl)piperazin-1-yl]-6-methyl-N-(2-methylpropyl)pyrimidin-4-amine |
| SMILES | Cc1cc(NCC(C)C)nc(N2CCN(c3cccc(Cl)c3)CC2)n1 |
| InChI | InChI=1S/C19H26ClN5/c1-14(2)13-21-18-11-15(3)22-19(23-18)25-9-7-24(8-10-25)17-6-4-5-16(20)12-17/h4-6,11-12,14H,7-10,13H2,1-3H3,(H,21,22,23) |
| InChIKey | FPTISSISOBMFSM-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.91 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |