C16H21ClN6 — CID 112938357
3-[4-(3-chlorophenyl)piperazin-1-yl]-N-propyl-1,2,4-triazin-5-amine (PubChem CID 112938357) has the molecular formula C16H21ClN6 and a molecular weight of 332.84 g/mol. Its IUPAC name is 3-[4-(3-chlorophenyl)piperazin-1-yl]-N-propyl-1,2,4-triazin-5-amine.
| Compound Name | 3-[4-(3-chlorophenyl)piperazin-1-yl]-N-propyl-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 112938357 |
| Molecular Formula | C16H21ClN6 |
| Molecular Weight | 332.84 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 3-[4-(3-chlorophenyl)piperazin-1-yl]-N-propyl-1,2,4-triazin-5-amine |
| SMILES | CCCNc1cnnc(N2CCN(c3cccc(Cl)c3)CC2)n1 |
| InChI | InChI=1S/C16H21ClN6/c1-2-6-18-15-12-19-21-16(20-15)23-9-7-22(8-10-23)14-5-3-4-13(17)11-14/h3-5,11-12H,2,6-10H2,1H3,(H,18,20,21) |
| InChIKey | GJGWYFSLRPLRFF-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.84 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |