C22H25N5O2 — CID 112873702
furan-2-yl-[4-[2-methyl-6-(2-phenylethylamino)pyrimidin-4-yl]piperazin-1-yl]methanone (PubChem CID 112873702) has the molecular formula C22H25N5O2 and a molecular weight of 391.48 g/mol. Its IUPAC name is furan-2-yl-[4-[2-methyl-6-(2-phenylethylamino)pyrimidin-4-yl]piperazin-1-yl]methanone.
| Compound Name | furan-2-yl-[4-[2-methyl-6-(2-phenylethylamino)pyrimidin-4-yl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 112873702 |
| Molecular Formula | C22H25N5O2 |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | furan-2-yl-[4-[2-methyl-6-(2-phenylethylamino)pyrimidin-4-yl]piperazin-1-yl]methanone |
| SMILES | Cc1nc(NCCc2ccccc2)cc(N2CCN(C(=O)c3ccco3)CC2)n1 |
| InChI | InChI=1S/C22H25N5O2/c1-17-24-20(23-10-9-18-6-3-2-4-7-18)16-21(25-17)26-11-13-27(14-12-26)22(28)19-8-5-15-29-19/h2-8,15-16H,9-14H2,1H3,(H,23,24,25) |
| InChIKey | XMUBLHXSOIJQOG-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |