C21H24N6O2 — CID 112957733
furan-2-yl-[4-[3-(3-phenylpropylamino)-1,2,4-triazin-5-yl]piperazin-1-yl]methanone (PubChem CID 112957733) has the molecular formula C21H24N6O2 and a molecular weight of 392.46 g/mol. Its IUPAC name is furan-2-yl-[4-[3-(3-phenylpropylamino)-1,2,4-triazin-5-yl]piperazin-1-yl]methanone.
| Compound Name | furan-2-yl-[4-[3-(3-phenylpropylamino)-1,2,4-triazin-5-yl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 112957733 |
| Molecular Formula | C21H24N6O2 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | furan-2-yl-[4-[3-(3-phenylpropylamino)-1,2,4-triazin-5-yl]piperazin-1-yl]methanone |
| SMILES | O=C(c1ccco1)N1CCN(c2cnnc(NCCCc3ccccc3)n2)CC1 |
| InChI | InChI=1S/C21H24N6O2/c28-20(18-9-5-15-29-18)27-13-11-26(12-14-27)19-16-23-25-21(24-19)22-10-4-8-17-6-2-1-3-7-17/h1-3,5-7,9,15-16H,4,8,10-14H2,(H,22,24,25) |
| InChIKey | CZYXMKJSBHXUFS-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|