C21H28FN5 — CID 112922347
1-[2-[4-(4-fluorophenyl)piperazin-1-yl]-6-methylpyrimidin-4-yl]azepane (PubChem CID 112922347) has the molecular formula C21H28FN5 and a molecular weight of 369.49 g/mol. Its IUPAC name is 1-[2-[4-(4-fluorophenyl)piperazin-1-yl]-6-methylpyrimidin-4-yl]azepane.
| Compound Name | 1-[2-[4-(4-fluorophenyl)piperazin-1-yl]-6-methylpyrimidin-4-yl]azepane |
|---|---|
| PubChem CID | 112922347 |
| Molecular Formula | C21H28FN5 |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | 1-[2-[4-(4-fluorophenyl)piperazin-1-yl]-6-methylpyrimidin-4-yl]azepane |
| SMILES | Cc1cc(N2CCCCCC2)nc(N2CCN(c3ccc(F)cc3)CC2)n1 |
| InChI | InChI=1S/C21H28FN5/c1-17-16-20(26-10-4-2-3-5-11-26)24-21(23-17)27-14-12-25(13-15-27)19-8-6-18(22)7-9-19/h6-9,16H,2-5,10-15H2,1H3 |
| InChIKey | VVLPKDRRGQZXBT-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 35.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |