C20H26FN5 — CID 146074504
2-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]-4-methyl-6-pyrrolidin-1-ylpyrimidine (PubChem CID 146074504) has the molecular formula C20H26FN5 and a molecular weight of 355.46 g/mol. Its IUPAC name is 2-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]-4-methyl-6-pyrrolidin-1-ylpyrimidine.
| Compound Name | 2-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]-4-methyl-6-pyrrolidin-1-ylpyrimidine |
|---|---|
| PubChem CID | 146074504 |
| Molecular Formula | C20H26FN5 |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.22 |
| IUPAC Name | 2-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]-4-methyl-6-pyrrolidin-1-ylpyrimidine |
| SMILES | Cc1cc(N2CCCC2)nc(N2CCN(Cc3ccc(F)cc3)CC2)n1 |
| InChI | InChI=1S/C20H26FN5/c1-16-14-19(25-8-2-3-9-25)23-20(22-16)26-12-10-24(11-13-26)15-17-4-6-18(21)7-5-17/h4-7,14H,2-3,8-13,15H2,1H3 |
| InChIKey | TVQKULXJEFALJJ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 35.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |