C20H24N6 — CID 171334402
2-[4-(6-methyl-2-pyrrolidin-1-ylpyrimidin-4-yl)piperazin-1-yl]benzonitrile (PubChem CID 171334402) has the molecular formula C20H24N6 and a molecular weight of 348.45 g/mol. Its IUPAC name is 2-[4-(6-methyl-2-pyrrolidin-1-ylpyrimidin-4-yl)piperazin-1-yl]benzonitrile.
| Compound Name | 2-[4-(6-methyl-2-pyrrolidin-1-ylpyrimidin-4-yl)piperazin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 171334402 |
| Molecular Formula | C20H24N6 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | 2-[4-(6-methyl-2-pyrrolidin-1-ylpyrimidin-4-yl)piperazin-1-yl]benzonitrile |
| SMILES | Cc1cc(N2CCN(c3ccccc3C#N)CC2)nc(N2CCCC2)n1 |
| InChI | InChI=1S/C20H24N6/c1-16-14-19(23-20(22-16)26-8-4-5-9-26)25-12-10-24(11-13-25)18-7-3-2-6-17(18)15-21/h2-3,6-7,14H,4-5,8-13H2,1H3 |
| InChIKey | WQSHZTXMXBAYIA-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 59.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |