C15H17F3N6 — CID 112746482
4-(4-benzylpiperazin-1-yl)-6-(trifluoromethyl)-1,3,5-triazin-2-amine (PubChem CID 112746482) has the molecular formula C15H17F3N6 and a molecular weight of 338.34 g/mol. Its IUPAC name is 4-(4-benzylpiperazin-1-yl)-6-(trifluoromethyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-(4-benzylpiperazin-1-yl)-6-(trifluoromethyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 112746482 |
| Molecular Formula | C15H17F3N6 |
| Molecular Weight | 338.34 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 4-(4-benzylpiperazin-1-yl)-6-(trifluoromethyl)-1,3,5-triazin-2-amine |
| SMILES | Nc1nc(N2CCN(Cc3ccccc3)CC2)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C15H17F3N6/c16-15(17,18)12-20-13(19)22-14(21-12)24-8-6-23(7-9-24)10-11-4-2-1-3-5-11/h1-5H,6-10H2,(H2,19,20,21,22) |
| InChIKey | ZYXMKPHMZHNHIU-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.34 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |